Difference between revisions of "CPD-19839"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common name: ** α-D-galactose * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19839 CPD-19839] == * common name: ** roseoflavin 5'-phosphate * inchi key: ** InChIKey=KBA...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19839 CPD-19839] == |
* common name: | * common name: | ||
| − | ** | + | ** roseoflavin 5'-phosphate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KBASEDIREZTYND-GUTXKFCHSA-K |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** CC1(C=C3(C(=CC(N(C)C)=1)N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C2(C(C(=O)[N-]C(=O)N=2)=N3))) |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 482.366 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 8-demethyl-8-(dimethylamino)riboflavin 5'-phosphate |
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-18511]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18510]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961035 126961035] |
| − | + | {{#set: common name=roseoflavin 5'-phosphate}} | |
| − | + | {{#set: inchi key=InChIKey=KBASEDIREZTYND-GUTXKFCHSA-K}} | |
| − | + | {{#set: smiles=CC1(C=C3(C(=CC(N(C)C)=1)N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C2(C(C(=O)[N-]C(=O)N=2)=N3)))}} | |
| − | {{#set: common name= | + | {{#set: molecular weight=482.366 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=8-demethyl-8-(dimethylamino)riboflavin 5'-phosphate}} |
| − | {{#set: smiles=C(O) | + | {{#set: consumed by=RXN-18511}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-18510}} |
| − | {{#set: common name= | ||
| − | {{#set: | ||
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite CPD-19839
- common name:
- roseoflavin 5'-phosphate
- inchi key:
- InChIKey=KBASEDIREZTYND-GUTXKFCHSA-K
- smiles:
- CC1(C=C3(C(=CC(N(C)C)=1)N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C2(C(C(=O)[N-]C(=O)N=2)=N3)))
- molecular weight:
- 482.366
- Synonym(s):
- 8-demethyl-8-(dimethylamino)riboflavin 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
Property "Smiles" (as page type) with input value "CC1(C=C3(C(=CC(N(C)C)=1)N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C2(C(C(=O)[N-]C(=O)N=2)=N3)))" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
