Difference between revisions of "P-AMINO-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-Amines Aryl-Amines] == * common name: ** an arylamine * Synonym(s): ** an aniline == Reac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * common name: ** 4-aminobenzoate * inchi key: ** InChIKe...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == |
* common name: | * common name: | ||
− | ** | + | ** 4-aminobenzoate |
+ | * inchi key: | ||
+ | ** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M | ||
+ | * smiles: | ||
+ | ** C(=O)([O-])C1(C=CC(=CC=1)N) | ||
+ | * molecular weight: | ||
+ | ** 136.13 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** para-aminobenzoic acid |
+ | ** p-aminobenzoic acid | ||
+ | ** para-aminobenzoate | ||
+ | ** p-aminobenzoate | ||
+ | ** 4-aminobenzoic acid | ||
+ | ** pABA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[H2PTEROATESYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876] |
− | {{#set: consumed by= | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568] | ||
+ | * GO-TERMS : (REFMET "P-Aminobenzoic acid" NIL midford 3701443689 NIL NIL) | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4710.html 4710] | ||
+ | * CAS : 150-13-0 | ||
+ | * BIGG : 4abz | ||
+ | * HMDB : HMDB01392 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836] | ||
+ | {{#set: common name=4-aminobenzoate}} | ||
+ | {{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}} | ||
+ | {{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}} | ||
+ | {{#set: molecular weight=136.13 }} | ||
+ | {{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}} | ||
+ | {{#set: consumed by=H2PTEROATESYNTH-RXN}} |
Latest revision as of 14:19, 15 January 2021
Contents
Metabolite P-AMINO-BENZOATE
- common name:
- 4-aminobenzoate
- inchi key:
- InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
- smiles:
- C(=O)([O-])C1(C=CC(=CC=1)N)
- molecular weight:
- 136.13
- Synonym(s):
- para-aminobenzoic acid
- p-aminobenzoic acid
- para-aminobenzoate
- p-aminobenzoate
- 4-aminobenzoic acid
- pABA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- LIGAND-CPD:
- GO-TERMS : (REFMET "P-Aminobenzoic acid" NIL midford 3701443689 NIL NIL)
- CHEMSPIDER:
- CAS : 150-13-0
- BIGG : 4abz
- HMDB : HMDB01392
- CHEBI:
Property "Smiles" (as page type) with input value "C(=O)([O-])C1(C=CC(=CC=1)N)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.