Difference between revisions of "Cis-delta21-3-oxo-C40-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * molecular-weight: ** 959.791 * inchi-key: ** ayordfmyybnsbo-qccsjadrsa...")
 
(Created page with "Category:metabolite == Metabolite CPD-710 == * common-name: ** campestanol * molecular-weight: ** 402.702 * inchi-key: ** arytxmneanmlmu-atedbjntsa-n * smiles: ** cc(c)c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19151 ==
+
== Metabolite CPD-710 ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+
** campestanol
 
* molecular-weight:
 
* molecular-weight:
** 959.791
+
** 402.702
 
* inchi-key:
 
* inchi-key:
** ayordfmyybnsbo-qccsjadrsa-j
+
** arytxmneanmlmu-atedbjntsa-n
 
* smiles:
 
* smiles:
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17798]]
+
* [[RXN-773]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17797]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=campestanol}}
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=402.702}}
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
+
{{#set: inchi-key=inchikey=arytxmneanmlmu-atedbjntsa-n}}

Revision as of 17:49, 13 January 2021

Metabolite CPD-710

  • common-name:
    • campestanol
  • molecular-weight:
    • 402.702
  • inchi-key:
    • arytxmneanmlmu-atedbjntsa-n
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality