Difference between revisions of "CPD-444"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite epoxides == * common-name: ** an epoxide == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite CPD-17370 == * common-name: ** 18-hydroxyoleoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** mqacsuxwiyyzak-utnxwdcosa-j * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17370 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 18-hydroxyoleoyl-coa |
| + | * molecular-weight: | ||
| + | ** 1043.952 | ||
| + | * inchi-key: | ||
| + | ** mqacsuxwiyyzak-utnxwdcosa-j | ||
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16402]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=18-hydroxyoleoyl-coa}} |
| + | {{#set: molecular-weight=1043.952}} | ||
| + | {{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}} | ||
Revision as of 17:49, 13 January 2021
Contents
Metabolite CPD-17370
- common-name:
- 18-hydroxyoleoyl-coa
- molecular-weight:
- 1043.952
- inchi-key:
- mqacsuxwiyyzak-utnxwdcosa-j
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
