Difference between revisions of "Charged-CYS-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-vaccen-2-enoyl-ACPs == * common-name: ** a (2e,11z)-octadeca-2,11-dienoyl-[acp] == Reaction(s) known to consume the compound == * R...") |
(Created page with "Category:metabolite == Metabolite S-CITRAMALATE == * common-name: ** (s)-citramalate * molecular-weight: ** 146.099 * inchi-key: ** xftrtwqbiomvpk-yfkpbyrvsa-l * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-CITRAMALATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-citramalate |
| + | * molecular-weight: | ||
| + | ** 146.099 | ||
| + | * inchi-key: | ||
| + | ** xftrtwqbiomvpk-yfkpbyrvsa-l | ||
| + | * smiles: | ||
| + | ** cc(o)(c(=o)[o-])cc(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[CITRAMALATE-LYASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[CITRAMALATE-LYASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-citramalate}} |
| + | {{#set: molecular-weight=146.099}} | ||
| + | {{#set: inchi-key=inchikey=xftrtwqbiomvpk-yfkpbyrvsa-l}} | ||
Revision as of 17:49, 13 January 2021
Contents
Metabolite S-CITRAMALATE
- common-name:
- (s)-citramalate
- molecular-weight:
- 146.099
- inchi-key:
- xftrtwqbiomvpk-yfkpbyrvsa-l
- smiles:
- cc(o)(c(=o)[o-])cc(=o)[o-]
