Difference between revisions of "D-GLUCARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * molecular-weight: ** 1102.034 * inchi-key: ** mmzjvinjfsr...")
 
(Created page with "Category:metabolite == Metabolite Cis-Delta5-dodecenoyl-ACPs == * common-name: ** a (5z)-dodec-5-enoyl-[acp] == Reaction(s) known to consume the compound == * [[RXN-10654]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17383 ==
+
== Metabolite Cis-Delta5-dodecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** (2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a (5z)-dodec-5-enoyl-[acp]
* molecular-weight:
 
** 1102.034
 
* inchi-key:
 
** mmzjvinjfsrjok-cynjbpnesa-j
 
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16131]]
+
* [[RXN-10654]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[RXN0-2145]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a (5z)-dodec-5-enoyl-[acp]}}
{{#set: molecular-weight=1102.034}}
 
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
 

Revision as of 17:49, 13 January 2021

Metabolite Cis-Delta5-dodecenoyl-ACPs

  • common-name:
    • a (5z)-dodec-5-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (5z)-dodec-5-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.