Difference between revisions of "Long-chain-alcohols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * molecular-weight: ** 222.177 * inchi-key: ** ycjnyhccoxvy...")
 
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-octanoyl-ACPs == * common-name: ** a (3r)-3-hydroxyoctanoyl-[acp] == Reaction(s) known to consume the compound == * 4.2.1.59-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11552 ==
+
== Metabolite 3-Hydroxy-octanoyl-ACPs ==
 
* common-name:
 
* common-name:
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** a (3r)-3-hydroxyoctanoyl-[acp]
* molecular-weight:
 
** 222.177
 
* inchi-key:
 
** ycjnyhccoxvyaf-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10721]]
+
* [[4.2.1.59-RXN]]
* [[RXN-10722]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10721]]
+
* [[RXN-9524]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=a (3r)-3-hydroxyoctanoyl-[acp]}}
{{#set: molecular-weight=222.177}}
 
{{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}}
 

Revision as of 17:50, 13 January 2021

Metabolite 3-Hydroxy-octanoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxyoctanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyoctanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.