Difference between revisions of "Phospho-DNA-directed-RNA-polymerases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * molecular-weight: ** 180.166 * inchi-key: ** qunwudvfrngtco-uhfffaoysa-n * smile...")
 
(Created page with "Category:metabolite == Metabolite Apo-EntF == * common-name: ** an apo-[entf l-seryl-carrier protein] == Reaction(s) known to consume the compound == * RXN-15889 == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-7-DIMETHYLXANTHINE ==
+
== Metabolite Apo-EntF ==
 
* common-name:
 
* common-name:
** paraxanthine
+
** an apo-[entf l-seryl-carrier protein]
* molecular-weight:
 
** 180.166
 
* inchi-key:
 
** qunwudvfrngtco-uhfffaoysa-n
 
* smiles:
 
** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11520]]
+
* [[RXN-15889]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=paraxanthine}}
+
{{#set: common-name=an apo-[entf l-seryl-carrier protein]}}
{{#set: molecular-weight=180.166}}
 
{{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}}
 

Revision as of 17:50, 13 January 2021

Metabolite Apo-EntF

  • common-name:
    • an apo-[entf l-seryl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[entf l-seryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.