Difference between revisions of "Aromatic-Amino-Acids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NEUROSPORENE == * common-name: ** all-trans neurosporene * molecular-weight: ** 538.898 * inchi-key: ** atcicvfrsjqydv-xilukmicsa-n * smi...")
 
(Created page with "Category:metabolite == Metabolite Double-Stranded-DNAs == * common-name: ** a double stranded dna == Reaction(s) known to consume the compound == * 3.1.21.4-RXN * 5....")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NEUROSPORENE ==
+
== Metabolite Double-Stranded-DNAs ==
 
* common-name:
 
* common-name:
** all-trans neurosporene
+
** a double stranded dna
* molecular-weight:
 
** 538.898
 
* inchi-key:
 
** atcicvfrsjqydv-xilukmicsa-n
 
* smiles:
 
** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8038]]
+
* [[3.1.21.4-RXN]]
* [[RXN-8040]]
+
* [[5.99.1.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[5.99.1.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans neurosporene}}
+
{{#set: common-name=a double stranded dna}}
{{#set: molecular-weight=538.898}}
 
{{#set: inchi-key=inchikey=atcicvfrsjqydv-xilukmicsa-n}}
 

Revision as of 17:50, 13 January 2021

Metabolite Double-Stranded-DNAs

  • common-name:
    • a double stranded dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality