Difference between revisions of "DNA-Guanines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * molecular-weight: ** 32.042 * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * smiles: ** co == Reaction...") |
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * molecular-weight: ** 158.11 * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * smiles: ** c(cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2K-ADIPATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-oxoadipate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 158.11 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fgsbnbbhozhubo-uhfffaoysa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc(=o)c(=o)[o-])cc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2-KETO-ADIPATE-DEHYDROG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-oxoadipate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=158.11}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}} |
Revision as of 17:50, 13 January 2021
Contents
Metabolite 2K-ADIPATE
- common-name:
- 2-oxoadipate
- molecular-weight:
- 158.11
- inchi-key:
- fgsbnbbhozhubo-uhfffaoysa-l
- smiles:
- c(cc(=o)c(=o)[o-])cc(=o)[o-]
