Difference between revisions of "ASN-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-RXN == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * molecular-weight: ** 999.899 * inchi-key: ** mjwmoldkmbisob-ydggzukgsa-j * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19144 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (7z)-hexadecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 999.899 | ||
| + | * inchi-key: | ||
| + | ** mjwmoldkmbisob-ydggzukgsa-j | ||
| + | * smiles: | ||
| + | ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17778]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(7z)-hexadecenoyl-coa}} |
| + | {{#set: molecular-weight=999.899}} | ||
| + | {{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}} | ||
Revision as of 17:50, 13 January 2021
Contents
Metabolite CPD-19144
- common-name:
- (7z)-hexadecenoyl-coa
- molecular-weight:
- 999.899
- inchi-key:
- mjwmoldkmbisob-ydggzukgsa-j
- smiles:
- ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
