Difference between revisions of "OH-ACYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11519 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa * molecular-weight: ** 1055.92 * inchi-k...") |
(Created page with "Category:metabolite == Metabolite D-METHYL-MALONYL-COA == * common-name: ** (s)-methylmalonyl-coa * molecular-weight: ** 862.568 * inchi-key: ** mzfokikepguzen-ibnuzsncsa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite D-METHYL-MALONYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-methylmalonyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 862.568 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mzfokikepguzen-ibnuzsncsa-i |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[METHYLMALONYL-COA-EPIM-RXN]] |
+ | * [[PROPIONYL-COA-CARBOXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[METHYLMALONYL-COA-EPIM-RXN]] |
+ | * [[PROPIONYL-COA-CARBOXY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-methylmalonyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=862.568}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mzfokikepguzen-ibnuzsncsa-i}} |
Revision as of 17:51, 13 January 2021
Contents
Metabolite D-METHYL-MALONYL-COA
- common-name:
- (s)-methylmalonyl-coa
- molecular-weight:
- 862.568
- inchi-key:
- mzfokikepguzen-ibnuzsncsa-i
- smiles:
- cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o