Difference between revisions of "GLYCOLLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** lgtvdwicxibioi-ubpkjmqesa-j *...")
 
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * molecular-weight: ** 214.111 * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17815 ==
+
== Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE ==
 
* common-name:
 
* common-name:
** (11z)-3-oxo-hexadecenoyl-coa
+
** 2-c-methyl-d-erythritol 4-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 1013.883
+
** 214.111
 
* inchi-key:
 
* inchi-key:
** lgtvdwicxibioi-ubpkjmqesa-j
+
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
 
* smiles:
 
* smiles:
** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(o)(co)c(o)cop([o-])([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16559]]
+
* [[2.7.7.60-RXN]]
* [[RXN-16561]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16559]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}}
+
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
{{#set: molecular-weight=1013.883}}
+
{{#set: molecular-weight=214.111}}
{{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}}
+
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}

Revision as of 17:51, 13 January 2021

Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol 4-phosphate
  • molecular-weight:
    • 214.111
  • inchi-key:
    • xmwhrvnvkdkbrg-uhnvwzdzsa-l
  • smiles:
    • cc(o)(co)c(o)cop([o-])([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality