Difference between revisions of "HYPOXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common_name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...")
 
(Created page with "Category:metabolite == Metabolite 1-4-beta-Xylan == * common-name: ** a (1→4)-β-d-xylan == Reaction(s) known to consume the compound == * 3.2.1.8-RXN == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BENZOYLSUCCINYL-COA ==
+
== Metabolite 1-4-beta-Xylan ==
* common_name:
+
* common-name:
** benzoylsuccinyl-coa
+
** a (1→4)-β-d-xylan
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi_key:
 
** inchikey=sgnpjinsckfitg-ihebcorqsa-i
 
* molecular_weight:
 
** 966.676   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.1.8-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-905]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=benzoylsuccinyl-coa}}
+
{{#set: common-name=a (1→4)-β-d-xylan}}
{{#set: inchi_key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
 
{{#set: molecular_weight=966.676    }}
 

Revision as of 17:51, 13 January 2021

Metabolite 1-4-beta-Xylan

  • common-name:
    • a (1→4)-β-d-xylan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality