Difference between revisions of "ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleoyl-sn-glycerol 3-phosphate * molecular-weight: ** 434.509 * inchi-key: ** wrgqswvcfniunz...")
 
(Created page with "Category:metabolite == Metabolite CPD-706 == * common-name: ** 24-methylenecholesterol * molecular-weight: ** 398.671 * inchi-key: ** indvlxyucbvvkw-pxbbazsnsa-n * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-LYSOPHOSPHATIDATE ==
+
== Metabolite CPD-706 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-sn-glycerol 3-phosphate
+
** 24-methylenecholesterol
 
* molecular-weight:
 
* molecular-weight:
** 434.509
+
** 398.671
 
* inchi-key:
 
* inchi-key:
** wrgqswvcfniunz-gdckjwnlsa-l
+
** indvlxyucbvvkw-pxbbazsnsa-n
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15043]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15045]]
+
* [[RXN-707]]
* [[RXN-15046]]
 
* [[RXN-15068]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-sn-glycerol 3-phosphate}}
+
{{#set: common-name=24-methylenecholesterol}}
{{#set: molecular-weight=434.509}}
+
{{#set: molecular-weight=398.671}}
{{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}}
+
{{#set: inchi-key=inchikey=indvlxyucbvvkw-pxbbazsnsa-n}}

Revision as of 17:51, 13 January 2021

Metabolite CPD-706

  • common-name:
    • 24-methylenecholesterol
  • molecular-weight:
    • 398.671
  • inchi-key:
    • indvlxyucbvvkw-pxbbazsnsa-n
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality