Difference between revisions of "CPD-464"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** lhayytcfpmuqnr-dfxypyg...")
 
(Created page with "Category:metabolite == Metabolite CADAVERINE == * common-name: ** cadaverine * molecular-weight: ** 104.195 * inchi-key: ** vhrgrcvqafmjiz-uhfffaoysa-p * smiles: ** c([n+]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19171 ==
+
== Metabolite CADAVERINE ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
+
** cadaverine
 
* molecular-weight:
 
* molecular-weight:
** 1043.952
+
** 104.195
 
* inchi-key:
 
* inchi-key:
** lhayytcfpmuqnr-dfxypyghsa-j
+
** vhrgrcvqafmjiz-uhfffaoysa-p
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c([n+])cccc[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17777]]
+
* [[RXN-11784]]
 +
* [[RXN0-5217]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17776]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=cadaverine}}
{{#set: molecular-weight=1043.952}}
+
{{#set: molecular-weight=104.195}}
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
+
{{#set: inchi-key=inchikey=vhrgrcvqafmjiz-uhfffaoysa-p}}

Revision as of 17:51, 13 January 2021

Metabolite CADAVERINE

  • common-name:
    • cadaverine
  • molecular-weight:
    • 104.195
  • inchi-key:
    • vhrgrcvqafmjiz-uhfffaoysa-p
  • smiles:
    • c([n+])cccc[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality