Difference between revisions of "N-4-aminobutylidene-enzyme-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16458 == * common-name: ** 7,8-dihydrolumazine * molecular-weight: ** 166.139 * inchi-key: ** myjneehzesremo-uhfffaoysa-n * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite mature-tRNA == * common-name: ** mature trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16458 ==
+
== Metabolite mature-tRNA ==
 
* common-name:
 
* common-name:
** 7,8-dihydrolumazine
+
** mature trna
* molecular-weight:
 
** 166.139
 
* inchi-key:
 
** myjneehzesremo-uhfffaoysa-n
 
* smiles:
 
** c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15261]]
+
* [[3.1.26.11-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydrolumazine}}
+
{{#set: common-name=mature trna}}
{{#set: molecular-weight=166.139}}
 
{{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}}
 

Revision as of 17:51, 13 January 2021

Metabolite mature-tRNA

  • common-name:
    • mature trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality