Difference between revisions of "DUMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14426 == * common-name: ** (7z,10z,13z,16z,19z)-docosapentaenoyl-coa * molecular-weight: ** 1075.997 * inchi-key: ** ndrvwkxewnmeeo-h...")
 
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine * molecular-weight: ** 296...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14426 ==
+
== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
 
* common-name:
 
* common-name:
** (7z,10z,13z,16z,19z)-docosapentaenoyl-coa
+
** 4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine
 
* molecular-weight:
 
* molecular-weight:
** 1075.997
+
** 296.093
 
* inchi-key:
 
* inchi-key:
** ndrvwkxewnmeeo-hvganwhpsa-j
+
** agqjqcfepuvxnk-uhfffaoysa-k
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16082]]
+
* [[RXN-12610]]
 +
* [[RXN-12611]]
 +
* [[THI-P-SYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13445]]
+
* [[PYRIMSYN3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7z,10z,13z,16z,19z)-docosapentaenoyl-coa}}
+
{{#set: common-name=4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine}}
{{#set: molecular-weight=1075.997}}
+
{{#set: molecular-weight=296.093}}
{{#set: inchi-key=inchikey=ndrvwkxewnmeeo-hvganwhpsa-j}}
+
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}

Revision as of 17:51, 13 January 2021

Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP

  • common-name:
    • 4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine
  • molecular-weight:
    • 296.093
  • inchi-key:
    • agqjqcfepuvxnk-uhfffaoysa-k
  • smiles:
    • cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality