Difference between revisions of "CPD-7671"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2187 == * common-name: ** 1-18:1-2-16:0-monogalactosyldiacylglycerol * molecular-weight: ** 757.099 * inchi-key: ** jbzbyhkcrfixbi-ot...") |
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * molecul...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite C1 == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1189.924 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** imwoxezvyqdrdf-mczxnmlpsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(=o)op([o-])(=o)occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PHOSNACMURPENTATRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1189.924}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}} |
Revision as of 17:51, 13 January 2021
Contents
Metabolite C1
- common-name:
- udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
- molecular-weight:
- 1189.924
- inchi-key:
- imwoxezvyqdrdf-mczxnmlpsa-j
- smiles:
- cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(=o)op([o-])(=o)occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))
