Difference between revisions of "Cytochromes-C-Oxidized"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * molecular-weight: ** 271.097 * inchi-key: ** aiqdykmwenwvqj-qiuujyrfsa-k...")
 
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P == * common-name: ** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-510 ==
+
== Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P ==
 
* common-name:
 
* common-name:
** α-d-glucuronate 1-phosphate
+
** 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate
* molecular-weight:
 
** 271.097
 
* inchi-key:
 
** aiqdykmwenwvqj-qiuujyrfsa-k
 
* smiles:
 
** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.44-RXN]]
+
* [[PGPPHOSPHA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.44-RXN]]
+
* [[PHOSPHAGLYPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucuronate 1-phosphate}}
+
{{#set: common-name=1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate}}
{{#set: molecular-weight=271.097}}
 
{{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}}
 

Revision as of 17:51, 13 January 2021

Metabolite L-1-PHOSPHATIDYL-GLYCEROL-P

  • common-name:
    • 1-(3-sn-phosphatidyl)-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality