Difference between revisions of "Long-Chain-oxoacyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs == * common-name: ** a cis-methoxy-c59-meroacyl-[acp] == Reaction(s) known to consume the compound == * [...")
 
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * molecular-weight: ** 492.013 * inchi-key: ** cipfcgzlfxvxbg-cnw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite cis-19-CP-37-Mex-38-Me-C59-ACPs ==
+
== Metabolite CPD-506 ==
 
* common-name:
 
* common-name:
** a cis-methoxy-c59-meroacyl-[acp]
+
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
 +
* molecular-weight:
 +
** 492.013
 +
* inchi-key:
 +
** cipfcgzlfxvxbg-cnwjwelysa-f
 +
* smiles:
 +
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-4140]]
+
* [[3.1.3.62-RXN]]
 +
* [[RXN-8730]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-2544]]
+
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cis-methoxy-c59-meroacyl-[acp]}}
+
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
 +
{{#set: molecular-weight=492.013}}
 +
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}

Revision as of 17:51, 13 January 2021

Metabolite CPD-506

  • common-name:
    • d-myo-inositol (1,3,4,5)-tetrakisphosphate
  • molecular-weight:
    • 492.013
  • inchi-key:
    • cipfcgzlfxvxbg-cnwjwelysa-f
  • smiles:
    • c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality