Difference between revisions of "Fatty-Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12199 == * common-name: ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa * molecular-weight: ** 927.663 * inchi-key: ** vddfxumtxcqmfm...")
 
(Created page with "Category:metabolite == Metabolite CPD-30 == * common-name: ** 4-acetamidobutanal * molecular-weight: ** 129.158 * inchi-key: ** ddslgzoyepkpsj-uhfffaoysa-n * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12199 ==
+
== Metabolite CPD-30 ==
 
* common-name:
 
* common-name:
** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
+
** 4-acetamidobutanal
 
* molecular-weight:
 
* molecular-weight:
** 927.663
+
** 129.158
 
* inchi-key:
 
* inchi-key:
** vddfxumtxcqmfm-ugdqnksbsa-j
+
** ddslgzoyepkpsj-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(nccc[ch]=o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11245]]
+
* [[RXN-37]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11244]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}}
+
{{#set: common-name=4-acetamidobutanal}}
{{#set: molecular-weight=927.663}}
+
{{#set: molecular-weight=129.158}}
{{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}}
+
{{#set: inchi-key=inchikey=ddslgzoyepkpsj-uhfffaoysa-n}}

Revision as of 17:52, 13 January 2021

Metabolite CPD-30

  • common-name:
    • 4-acetamidobutanal
  • molecular-weight:
    • 129.158
  • inchi-key:
    • ddslgzoyepkpsj-uhfffaoysa-n
  • smiles:
    • cc(nccc[ch]=o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality