Difference between revisions of "5-10-METHENYL-THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FE+2 == * common-name: ** fe2+ * molecular-weight: ** 55.847 * inchi-key: ** cwynvvgooaeacu-uhfffaoysa-n * smiles: ** [fe++] == Reaction(...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * molecular-weight: ** 228.095 * inchi-key: ** yxjdfqjkerbobm-txicztdvsa-l *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RIBOSE-1P == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-ribose-1-phosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 228.095 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yxjdfqjkerbobm-txicztdvsa-l |
* smiles: | * smiles: | ||
− | ** [ | + | ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[INOPHOSPHOR-RXN]] |
− | + | * [[PPENTOMUT-RXN]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[INOPHOSPHOR-RXN]] |
− | + | * [[PPENTOMUT-RXN]] | |
− | * [[ | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-ribose-1-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.095}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}} |
Revision as of 17:52, 13 January 2021
Contents
Metabolite RIBOSE-1P
- common-name:
- α-d-ribose-1-phosphate
- molecular-weight:
- 228.095
- inchi-key:
- yxjdfqjkerbobm-txicztdvsa-l
- smiles:
- c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)