Difference between revisions of "CPD-1789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * molecular-weight: ** 178.141 * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-n * smil...")
 
(Created page with "Category:metabolite == Metabolite carboxybiotin-L-lysine-in-BCCP-dimers == * common-name: ** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1242 ==
+
== Metabolite carboxybiotin-L-lysine-in-BCCP-dimers ==
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine
* molecular-weight:
 
** 178.141
 
* inchi-key:
 
** apiqnbnbiiccon-fkmsrsahsa-n
 
* smiles:
 
** c(o)c1(oc(c(c(c1o)=o)o)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOLACTOSE-RXN]]
+
* [[BIOTIN-CARBOXYL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: common-name=a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine}}
{{#set: molecular-weight=178.141}}
 
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
 

Revision as of 17:52, 13 January 2021

Metabolite carboxybiotin-L-lysine-in-BCCP-dimers

  • common-name:
    • a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.