Difference between revisions of "GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * common-name: ** cis-aconitate * molecular-weight: ** 171.086 * inchi-key: ** gtzcvfvgugfeme-iwqzzhsrsa-k * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CIS-ACONITATE ==
+
== Metabolite Elongation-tRNAMet ==
 
* common-name:
 
* common-name:
** cis-aconitate
+
** elongator trnamet
* molecular-weight:
 
** 171.086
 
* inchi-key:
 
** gtzcvfvgugfeme-iwqzzhsrsa-k
 
* smiles:
 
** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
* [[ACONITATEHYDR-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEDEHYDR-RXN]]
 
* [[ACONITATEHYDR-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-aconitate}}
+
{{#set: common-name=elongator trnamet}}
{{#set: molecular-weight=171.086}}
 
{{#set: inchi-key=inchikey=gtzcvfvgugfeme-iwqzzhsrsa-k}}
 

Revision as of 17:52, 13 January 2021

Metabolite Elongation-tRNAMet

  • common-name:
    • elongator trnamet

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality