Difference between revisions of "I-Antigens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * molecular-weight: ** 464.112 * inchi-key: ** ahcymluzirlxaa-shyzeuofsa-j * smiles: ** c(c2(c(cc(n1(c(nc(...")
 
(Created page with "Category:metabolite == Metabolite Spliced-tRNA-precursor == * common_name: ** a spliced trna == Reaction(s) known to consume the compound == == Reaction(s) known to produc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUTP ==
+
== Metabolite Spliced-tRNA-precursor ==
* common-name:
+
* common_name:
** dutp
+
** a spliced trna
* molecular-weight:
 
** 464.112
 
* inchi-key:
 
** ahcymluzirlxaa-shyzeuofsa-j
 
* smiles:
 
** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DUTP-PYROP-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DUDPKIN-RXN]]
+
* [[2.7.1.160-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dutp}}
+
{{#set: common_name=a spliced trna}}
{{#set: molecular-weight=464.112}}
 
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
 

Revision as of 17:52, 13 January 2021

Metabolite Spliced-tRNA-precursor

  • common_name:
    • a spliced trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality