Difference between revisions of "CPD-194"

Revision as of 17:52, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15566 ==
+== Metabolite CPD-13524 ==
 * common-name:
-** (2e,4e)-tetradeca-2,4-dienoyl-coa
+** all-trans-retinol
 * molecular-weight:
-** 969.83
+** 286.456
 * inchi-key:
-** ulogshzmdlrqry-inbgbncrsa-j
+** fpipgxgpppqfeq-ovsjkpmpsa-n
 * smiles:
-** cccccccccc=cc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 == Reaction(s) known to consume the compound ==
-* [[RXN-14715]]
+* [[1.3.99.23-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RXN-10841]]
 == Reaction(s) known to produce the compound ==
+* [[3.1.1.64-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12575]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,4e)-tetradeca-2,4-dienoyl-coa}}
+{{#set: common-name=all-trans-retinol}}
-{{#set: molecular-weight=969.83}}
+{{#set: molecular-weight=286.456}}
-{{#set: inchi-key=inchikey=ulogshzmdlrqry-inbgbncrsa-j}}
+{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}