Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * molecular-weight: ** 306.313 * inchi-key: ** rwsxrvcmgqzwbv-wdskdsinsa-m * smiles: ** c(s)...")
 
(Created page with "Category:metabolite == Metabolite APS == * common-name: ** adenosine 5'-phosphosulfate * molecular-weight: ** 425.266 * inchi-key: ** irlpacmltupbcl-kqynxxcusa-l * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite GLUTATHIONE ==
+
== Metabolite APS ==
 
* common-name:
 
* common-name:
−
** glutathione
+
** adenosine 5'-phosphosulfate
 
* molecular-weight:
 
* molecular-weight:
−
** 306.313
+
** 425.266
 
* inchi-key:
 
* inchi-key:
−
** rwsxrvcmgqzwbv-wdskdsinsa-m
+
** irlpacmltupbcl-kqynxxcusa-l
 
* smiles:
 
* smiles:
−
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[1.11.1.12-RXN]]
+
* [[ADENYLYLSULFATASE-RXN]]
−
* [[1.8.5.1-RXN]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
−
* [[2.3.2.15-RXN]]
+
* [[ADENYLYLSULFKIN-RXN]]
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[R163-RXN]]
−
* [[GLYOXI-RXN]]
+
* [[SULFATE-ADENYLYLTRANS-RXN]]
−
* [[GSHTRAN-RXN]]
 
−
* [[GST-RXN]]
 
−
* [[PRODISULFREDUCT-A-RXN]]
 
−
* [[RXN-13673]]
 
−
* [[RXN-15680]]
 
−
* [[RXN-6601]]
 
−
* [[RXN-9157]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
−
* [[GLUTATHIONE-SYN-RXN]]
+
* [[ADENYLYLSULFKIN-RXN]]
−
* [[GLYOXI-RXN]]
+
* [[R163-RXN]]
−
* [[GLYOXII-RXN]]
+
* [[SULFATE-ADENYLYLTRANS-RXN]]
−
* [[RXN-13161]]
 
−
* [[RXN-15348]]
 
−
* [[RXN-16574]]
 
−
* [[RXN-2961]]
 
−
* [[RXN-7919]]
 
−
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=glutathione}}
+
{{#set: common-name=adenosine 5'-phosphosulfate}}
−
{{#set: molecular-weight=306.313}}
+
{{#set: molecular-weight=425.266}}
−
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=irlpacmltupbcl-kqynxxcusa-l}}

Revision as of 17:52, 13 January 2021

Metabolite APS

  • common-name:
    • adenosine 5'-phosphosulfate
  • molecular-weight:
    • 425.266
  • inchi-key:
    • irlpacmltupbcl-kqynxxcusa-l
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(os(=o)([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=NN-DIMETHYLANILINE-N-OXIDE&oldid=17421"