Difference between revisions of "Protein-Lysine-Aminocarbinol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10284 == * common-name: ** 3-oxo-myristoyl-coa * molecular-weight: ** 987.845 * inchi-key: ** iqnfbghlivbnou-qsgbvpjfsa-j * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite CPD-13576 == * common-name: ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate * molecular-weight: ** 264.169 * inchi-key: ** xwecmahak...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10284 ==
+
== Metabolite CPD-13576 ==
 
* common-name:
 
* common-name:
** 3-oxo-myristoyl-coa
+
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
 
* molecular-weight:
 
* molecular-weight:
** 987.845
+
** 264.169
 
* inchi-key:
 
* inchi-key:
** iqnfbghlivbnou-qsgbvpjfsa-j
+
** xwecmahakfwynv-uhfffaoysa-k
 
* smiles:
 
* smiles:
** cccccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14268]]
+
* [[RXN-12610]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12507]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-myristoyl-coa}}
+
{{#set: common-name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
{{#set: molecular-weight=987.845}}
+
{{#set: molecular-weight=264.169}}
{{#set: inchi-key=inchikey=iqnfbghlivbnou-qsgbvpjfsa-j}}
+
{{#set: inchi-key=inchikey=xwecmahakfwynv-uhfffaoysa-k}}

Revision as of 17:52, 13 January 2021

Metabolite CPD-13576

  • common-name:
    • 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
  • molecular-weight:
    • 264.169
  • inchi-key:
    • xwecmahakfwynv-uhfffaoysa-k
  • smiles:
    • cc1(=c(ccop([o-])(=o)[o-])sc(c(=o)[o-])=n1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality