Difference between revisions of "CPD-1083"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-arabinofuranose == == Reaction(s) known to consume the compound == * RXN-14809 == Reaction(s) known to produce the compound == * ...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P == * common-name: ** 7,8-dihydroneopterin 3'-phosphate * molecular-weight: ** 333.197 * inchi-key: ** plsqmgzyogsoce-x...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRONEOPTERIN-P == |
| + | * common-name: | ||
| + | ** 7,8-dihydroneopterin 3'-phosphate | ||
| + | * molecular-weight: | ||
| + | ** 333.197 | ||
| + | * inchi-key: | ||
| + | ** plsqmgzyogsoce-xinawcovsa-l | ||
| + | * smiles: | ||
| + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=7,8-dihydroneopterin 3'-phosphate}} | ||
| + | {{#set: molecular-weight=333.197}} | ||
| + | {{#set: inchi-key=inchikey=plsqmgzyogsoce-xinawcovsa-l}} | ||
Revision as of 17:52, 13 January 2021
Contents
Metabolite DIHYDRONEOPTERIN-P
- common-name:
- 7,8-dihydroneopterin 3'-phosphate
- molecular-weight:
- 333.197
- inchi-key:
- plsqmgzyogsoce-xinawcovsa-l
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop(=o)([o-])[o-])=2))
