Difference between revisions of "PROT-CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Poly-beta-D-Mannuronate == * common-name: ** mannuronan == Reaction(s) known to consume the compound == * RXN-9839 == Reaction(s) kno...")
 
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-gtubxknvsa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Poly-beta-D-Mannuronate ==
+
== Metabolite CPD-15666 ==
 
* common-name:
 
* common-name:
** mannuronan
+
** 2-trans,6-cis-tridecadienoyl-coa
 +
* molecular-weight:
 +
** 955.803
 +
* inchi-key:
 +
** oosdlbaxvxkfib-gtubxknvsa-j
 +
* smiles:
 +
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9839]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14771]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mannuronan}}
+
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
 +
{{#set: molecular-weight=955.803}}
 +
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}

Revision as of 17:53, 13 January 2021

Metabolite CPD-15666

  • common-name:
    • 2-trans,6-cis-tridecadienoyl-coa
  • molecular-weight:
    • 955.803
  • inchi-key:
    • oosdlbaxvxkfib-gtubxknvsa-j
  • smiles:
    • ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality