Difference between revisions of "FORMYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHURENATE == * common-name: ** xanthurenate * molecular-weight: ** 203.154 * inchi-key: ** fbzonxhggphhiy-uhfffaoysa-l * smiles: ** c1...")
 
(Created page with "Category:metabolite == Metabolite Amino-Acids == * common-name: ** an amino acid == Reaction(s) known to consume the compound == * GAMMA-GLUTAMYLTRANSFERASE-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHURENATE ==
+
== Metabolite Amino-Acids ==
 
* common-name:
 
* common-name:
** xanthurenate
+
** an amino acid
* molecular-weight:
 
** 203.154
 
* inchi-key:
 
** fbzonxhggphhiy-uhfffaoysa-l
 
* smiles:
 
** c1(=cc2(=c(c(o)=c1)n=c(c=c([o-])2)c(=o)[o-]))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10722]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthurenate}}
+
{{#set: common-name=an amino acid}}
{{#set: molecular-weight=203.154}}
 
{{#set: inchi-key=inchikey=fbzonxhggphhiy-uhfffaoysa-l}}
 

Revision as of 17:53, 13 January 2021

Metabolite Amino-Acids

  • common-name:
    • an amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality