Difference between revisions of "Cis-vaccenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** p1,p4-bis(5'-adenosyl) tetraphosphate * molecular-weight: ** 832.36 * inchi-key: ** yoahknvsncmzgq-xpwfq...")
 
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-bjbrngjvs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSYL-P4 ==
+
== Metabolite CPD-15675 ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-adenosyl) tetraphosphate
+
** 2-trans-6-trans-tridecadienoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 832.36
+
** 955.803
 
* inchi-key:
 
* inchi-key:
** yoahknvsncmzgq-xpwfqurosa-j
+
** oosdlbaxvxkfib-bjbrngjvsa-j
 
* smiles:
 
* smiles:
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
+
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
+
* [[RXN-14785]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-adenosyl) tetraphosphate}}
+
{{#set: common-name=2-trans-6-trans-tridecadienoyl-coa}}
{{#set: molecular-weight=832.36}}
+
{{#set: molecular-weight=955.803}}
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
+
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-bjbrngjvsa-j}}

Revision as of 17:53, 13 January 2021

Metabolite CPD-15675

  • common-name:
    • 2-trans-6-trans-tridecadienoyl-coa
  • molecular-weight:
    • 955.803
  • inchi-key:
    • oosdlbaxvxkfib-bjbrngjvsa-j
  • smiles:
    • ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality