Difference between revisions of "MTAC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALGINATE == * common-name: ** alginate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * molecular-weight: ** 225.094 * inchi-key: ** pjrxvijaernuip-vkhmyhe...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-GLUTAMATE-5-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl 5-phosphate |
| + | * molecular-weight: | ||
| + | ** 225.094 | ||
| + | * inchi-key: | ||
| + | ** pjrxvijaernuip-vkhmyheasa-l | ||
| + | * smiles: | ||
| + | ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GLUTKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl 5-phosphate}} |
| + | {{#set: molecular-weight=225.094}} | ||
| + | {{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}} | ||
Revision as of 17:53, 13 January 2021
Contents
Metabolite L-GLUTAMATE-5-P
- common-name:
- γ-l-glutamyl 5-phosphate
- molecular-weight:
- 225.094
- inchi-key:
- pjrxvijaernuip-vkhmyheasa-l
- smiles:
- c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
