Difference between revisions of "Cis-5-enoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-7-P == * common-name: ** d-sedoheptulose 7-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN...")
 
(Created page with "Category:metabolite == Metabolite L-CYSTATHIONINE == * common-name: ** l-cystathionine * molecular-weight: ** 222.259 * inchi-key: ** ilrylpwnyfxemh-whfbiakzsa-n * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-SEDOHEPTULOSE-7-P ==
+
== Metabolite L-CYSTATHIONINE ==
 
* common-name:
 
* common-name:
** d-sedoheptulose 7-phosphate
+
** l-cystathionine
 +
* molecular-weight:
 +
** 222.259
 +
* inchi-key:
 +
** ilrylpwnyfxemh-whfbiakzsa-n
 +
* smiles:
 +
** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1TRANSKETO-RXN]]
+
* [[CYSTATHIONASE-RXN]]
* [[TRANSALDOL-RXN]]
+
* [[CYSTATHIONINE-BETA-LYASE-RXN]]
 +
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
* [[RXN-14048]]
 +
* [[RXN-15130]]
 +
* [[RXN-15131]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1TRANSKETO-RXN]]
+
* [[CYSPH-RXN]]
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
+
* [[CYSTATHIONASE-RXN]]
* [[TRANSALDOL-RXN]]
+
* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-sedoheptulose 7-phosphate}}
+
{{#set: common-name=l-cystathionine}}
 +
{{#set: molecular-weight=222.259}}
 +
{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}

Revision as of 17:53, 13 January 2021

Metabolite L-CYSTATHIONINE

  • common-name:
    • l-cystathionine
  • molecular-weight:
    • 222.259
  • inchi-key:
    • ilrylpwnyfxemh-whfbiakzsa-n
  • smiles:
    • c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality