Difference between revisions of "CPD-334"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * molecular-weight: ** 319.333 * inchi-key: ** hpnsfsbzbahari-rudmxatfsa-m * smiles: ** cc(c...")
 
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-1835 == * common-name: ** a guanine1835 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11635 == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14601 ==
+
== Metabolite 23S-rRNA-guanine-1835 ==
 
* common-name:
 
* common-name:
** mycophenolate
+
** a guanine1835 in 23s rrna
* molecular-weight:
 
** 319.333
 
* inchi-key:
 
** hpnsfsbzbahari-rudmxatfsa-m
 
* smiles:
 
** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13607]]
+
* [[RXN-11635]]
* [[RXN-13608]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolate}}
+
{{#set: common-name=a guanine1835 in 23s rrna}}
{{#set: molecular-weight=319.333}}
 
{{#set: inchi-key=inchikey=hpnsfsbzbahari-rudmxatfsa-m}}
 

Revision as of 17:53, 13 January 2021

Metabolite 23S-rRNA-guanine-1835

  • common-name:
    • a guanine1835 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality