Difference between revisions of "ISOVALERYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-224 == * common-name: ** a dolichyl diphosphate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite CPD-11268 == * common-name: ** n1,n12-diacetylspermine * molecular-weight: ** 288.432 * inchi-key: ** npdtudwgjmbvep-uhfffaoysa-p * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11268 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n1,n12-diacetylspermine |
| + | * molecular-weight: | ||
| + | ** 288.432 | ||
| + | * inchi-key: | ||
| + | ** npdtudwgjmbvep-uhfffaoysa-p | ||
| + | * smiles: | ||
| + | ** cc(=o)nccc[n+]cccc[n+]cccnc(=o)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10460]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n1,n12-diacetylspermine}} |
| + | {{#set: molecular-weight=288.432}} | ||
| + | {{#set: inchi-key=inchikey=npdtudwgjmbvep-uhfffaoysa-p}} | ||
Revision as of 17:53, 13 January 2021
Contents
Metabolite CPD-11268
- common-name:
- n1,n12-diacetylspermine
- molecular-weight:
- 288.432
- inchi-key:
- npdtudwgjmbvep-uhfffaoysa-p
- smiles:
- cc(=o)nccc[n+]cccc[n+]cccnc(=o)c
