Difference between revisions of "2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10262 == * common-name: ** (2e)-octadec-2-enoyl-coa * molecular-weight: ** 1027.953 * inchi-key: ** nbccuihohukbmk-zddafbbhsa-j * smi...")
 
(Created page with "Category:metabolite == Metabolite DATP == * common-name: ** datp * molecular-weight: ** 487.152 * inchi-key: ** suyvubyjarfzho-rrkcrqdmsa-j * smiles: ** c(c3(c(cc(n2(c1(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10262 ==
+
== Metabolite DATP ==
 
* common-name:
 
* common-name:
** (2e)-octadec-2-enoyl-coa
+
** datp
 
* molecular-weight:
 
* molecular-weight:
** 1027.953
+
** 487.152
 
* inchi-key:
 
* inchi-key:
** nbccuihohukbmk-zddafbbhsa-j
+
** suyvubyjarfzho-rrkcrqdmsa-j
 
* smiles:
 
* smiles:
** cccccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9546]]
+
* [[RXN-14290]]
 +
* [[RXN0-384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DADPKIN-RXN]]
 +
* [[RXN-14192]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-octadec-2-enoyl-coa}}
+
{{#set: common-name=datp}}
{{#set: molecular-weight=1027.953}}
+
{{#set: molecular-weight=487.152}}
{{#set: inchi-key=inchikey=nbccuihohukbmk-zddafbbhsa-j}}
+
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}

Revision as of 17:54, 13 January 2021

Metabolite DATP

  • common-name:
    • datp
  • molecular-weight:
    • 487.152
  • inchi-key:
    • suyvubyjarfzho-rrkcrqdmsa-j
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality