Difference between revisions of "Phenols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * molecular-weight: ** 297.457 * inchi-key: ** lquhzvlttwmbto-uphrsurjsa-m * smile...")
 
(Created page with "Category:metabolite == Metabolite CPD-292 == * common-name: ** (2e)-hexadecenal * molecular-weight: ** 238.412 * inchi-key: ** kljfyxovgvxzkt-ccezhusrsa-n * smiles: ** ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 18-HYDROXYOLEATE ==
+
== Metabolite CPD-292 ==
 
* common-name:
 
* common-name:
** 18-hydroxyoleate
+
** (2e)-hexadecenal
 
* molecular-weight:
 
* molecular-weight:
** 297.457
+
** 238.412
 
* inchi-key:
 
* inchi-key:
** lquhzvlttwmbto-uphrsurjsa-m
+
** kljfyxovgvxzkt-ccezhusrsa-n
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(=o)[o-]
+
** cccccccccccccc=c[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16402]]
+
* [[RXN-16656]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3DJ-11230]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxyoleate}}
+
{{#set: common-name=(2e)-hexadecenal}}
{{#set: molecular-weight=297.457}}
+
{{#set: molecular-weight=238.412}}
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
+
{{#set: inchi-key=inchikey=kljfyxovgvxzkt-ccezhusrsa-n}}

Revision as of 17:54, 13 January 2021

Metabolite CPD-292

  • common-name:
    • (2e)-hexadecenal
  • molecular-weight:
    • 238.412
  • inchi-key:
    • kljfyxovgvxzkt-ccezhusrsa-n
  • smiles:
    • cccccccccccccc=c[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality