Difference between revisions of "Proteins-with-correct-disulfides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * inchi-key: ** kfwwcmjsysspsk-bogfjhsmsa-j * smiles: ** cc...")
 
(Created page with "Category:metabolite == Metabolite CPD1F-120 == * common-name: ** gibberellin a24 * molecular-weight: ** 344.407 * inchi-key: ** qqrsshfhxysomf-cxxojbqzsa-l * smiles: ** c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CROTONYL-COA ==
+
== Metabolite CPD1F-120 ==
 
* common-name:
 
* common-name:
** crotonyl-coa
+
** gibberellin a24
 
* molecular-weight:
 
* molecular-weight:
** 831.577
+
** 344.407
 
* inchi-key:
 
* inchi-key:
** kfwwcmjsysspsk-bogfjhsmsa-j
+
** qqrsshfhxysomf-cxxojbqzsa-l
 
* smiles:
 
* smiles:
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-11667]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[RXN1F-163]]
* [[RXN-11667]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=crotonyl-coa}}
+
{{#set: common-name=gibberellin a24}}
{{#set: molecular-weight=831.577}}
+
{{#set: molecular-weight=344.407}}
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
+
{{#set: inchi-key=inchikey=qqrsshfhxysomf-cxxojbqzsa-l}}

Revision as of 17:54, 13 January 2021

Metabolite CPD1F-120

  • common-name:
    • gibberellin a24
  • molecular-weight:
    • 344.407
  • inchi-key:
    • qqrsshfhxysomf-cxxojbqzsa-l
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality