Difference between revisions of "PHENYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24183 == == Reaction(s) known to consume the compound == * RXN-22205 == Reaction(s) known to produce the compound == * RXN-222...")
 
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuvuwaf-p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-24183 ==
+
== Metabolite 1-L-MYO-INOSITOL-1-P ==
 +
* common-name:
 +
** 1d-myo-inositol 3-monophosphate
 +
* molecular-weight:
 +
** 258.121
 +
* inchi-key:
 +
** inapmgsxuvuwaf-ptqmnwpwsa-l
 +
* smiles:
 +
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22205 ]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-22204]]
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN66-579]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
 +
{{#set: molecular-weight=258.121}}
 +
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}

Revision as of 17:54, 13 January 2021

Metabolite 1-L-MYO-INOSITOL-1-P

  • common-name:
    • 1d-myo-inositol 3-monophosphate
  • molecular-weight:
    • 258.121
  • inchi-key:
    • inapmgsxuvuwaf-ptqmnwpwsa-l
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality