Difference between revisions of "PHENYL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24183 == == Reaction(s) known to consume the compound == * RXN-22205 == Reaction(s) known to produce the compound == * RXN-222...") |
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuvuwaf-p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 1-L-MYO-INOSITOL-1-P == |
+ | * common-name: | ||
+ | ** 1d-myo-inositol 3-monophosphate | ||
+ | * molecular-weight: | ||
+ | ** 258.121 | ||
+ | * inchi-key: | ||
+ | ** inapmgsxuvuwaf-ptqmnwpwsa-l | ||
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] |
+ | * [[RXN66-579]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=1d-myo-inositol 3-monophosphate}} | ||
+ | {{#set: molecular-weight=258.121}} | ||
+ | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite 1-L-MYO-INOSITOL-1-P
- common-name:
- 1d-myo-inositol 3-monophosphate
- molecular-weight:
- 258.121
- inchi-key:
- inapmgsxuvuwaf-ptqmnwpwsa-l
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)