Difference between revisions of "CPD-17400"

Revision as of 17:54, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite TRYPTAMINE ==
+== Metabolite CPD-4618 ==
 * common-name:
-** tryptamine
+** cis-zeatin-7-n-glucoside
 * molecular-weight:
-** 161.226
+** 381.388
 * inchi-key:
-** apjydqyyacxcrm-uhfffaoysa-o
+** htdhrclvwuexis-gihywfgssa-n
 * smiles:
-** c([n+])cc1(=cnc2(c=cc=cc1=2))
+** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
 == Reaction(s) known to consume the compound ==
-* [[STRICTOSIDINE-SYNTHASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
+* [[RXN-4733]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=tryptamine}}
+{{#set: common-name=cis-zeatin-7-n-glucoside}}
-{{#set: molecular-weight=161.226}}
+{{#set: molecular-weight=381.388}}
-{{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}}
+{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}