Difference between revisions of "Gamma-linolenoyl-groups"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16013 == * common-name: ** 2-iminobutanoate * molecular-weight: ** 100.097 * inchi-key: ** wrbrcyppgucrhw-uhfffaoysa-m * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite CPD-12904 == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * molecular-weight: ** 871.642 * inchi-key: ** ifmyvrqehqtins-meoyllpmsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12904 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** (2e)-5-methylhexa-2,4-dienoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 871.642 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ifmyvrqehqtins-meoyllpmsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11919]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=871.642}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite CPD-12904
- common-name:
- (2e)-5-methylhexa-2,4-dienoyl-coa
- molecular-weight:
- 871.642
- inchi-key:
- ifmyvrqehqtins-meoyllpmsa-j
- smiles:
- cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
