Difference between revisions of "PALMITYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * molecular-weight: ** 1083.973 * inchi-key: ** fgcwebktqlbclr-jrszcninsa-j * smiles:...")
 
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * molecular-weight: ** 401.14 * inchi-key: ** xcctyiawtasojw-xvfcmesisa-k * smiles: ** c(op(=o)([o-])op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17401 ==
+
== Metabolite UDP ==
 
* common-name:
 
* common-name:
−
** 3-oxo-auricoloyl-coa
+
** udp
 
* molecular-weight:
 
* molecular-weight:
−
** 1083.973
+
** 401.14
 
* inchi-key:
 
* inchi-key:
−
** fgcwebktqlbclr-jrszcninsa-j
+
** xcctyiawtasojw-xvfcmesisa-k
 
* smiles:
 
* smiles:
−
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16154]]
+
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[ExchangeSeed-UDP]]
 +
* [[RXN-12197]]
 +
* [[RXN-16027]]
 +
* [[RXN0-722]]
 +
* [[TransportSeed-UDP]]
 +
* [[UDPKIN-RXN]]
 +
* [[UDPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[2.4.1.101-RXN]]
 +
* [[2.4.1.117-RXN]]
 +
* [[2.4.1.141-RXN]]
 +
* [[2.4.1.143-RXN]]
 +
* [[2.4.1.144-RXN]]
 +
* [[2.4.1.145-RXN]]
 +
* [[2.4.1.149-RXN]]
 +
* [[2.4.1.150-RXN]]
 +
* [[2.4.1.151-RXN]]
 +
* [[2.4.1.155-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.38-RXN]]
 +
* [[2.4.1.46-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.4.2.26-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[ExchangeSeed-UDP]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[RXN-10606]]
 +
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-12002]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-12196]]
 +
* [[RXN-1224]]
 +
* [[RXN-1225]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-15117]]
 +
* [[RXN-15276]]
 +
* [[RXN-15277]]
 +
* [[RXN-15278]]
 +
* [[RXN-16027]]
 +
* [[RXN-16975]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-7828]]
 +
* [[RXN-8228]]
 +
* [[RXN-9000]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[TransportSeed-UDP]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=udp}}
−
{{#set: molecular-weight=1083.973}}
+
{{#set: molecular-weight=401.14}}
−
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
+
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}

Revision as of 17:54, 13 January 2021

Metabolite UDP

  • common-name:
    • udp
  • molecular-weight:
    • 401.14
  • inchi-key:
    • xcctyiawtasojw-xvfcmesisa-k
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=PALMITYL-COA&oldid=17895"