Difference between revisions of "CARBON-DIOXIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phosphoserines == * common-name: ** l(or d)-o-phosphoserine == Reaction(s) known to consume the compound == * PSERPHOSPHA-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-12830 == * common-name: ** demethylphylloquinol * molecular-weight: ** 438.692 * inchi-key: ** aefnzggbwoqyid-kqpzccjbsa-n * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12830 == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylphylloquinol |
| + | * molecular-weight: | ||
| + | ** 438.692 | ||
| + | * inchi-key: | ||
| + | ** aefnzggbwoqyid-kqpzccjbsa-n | ||
| + | * smiles: | ||
| + | ** cc(cccc(cccc(c)cccc(=ccc2(c=c(o)c1(=c(c=cc=c1)c(o)=2)))c)c)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7569]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylphylloquinol}} |
| + | {{#set: molecular-weight=438.692}} | ||
| + | {{#set: inchi-key=inchikey=aefnzggbwoqyid-kqpzccjbsa-n}} | ||
Revision as of 17:54, 13 January 2021
Contents
Metabolite CPD-12830
- common-name:
- demethylphylloquinol
- molecular-weight:
- 438.692
- inchi-key:
- aefnzggbwoqyid-kqpzccjbsa-n
- smiles:
- cc(cccc(cccc(c)cccc(=ccc2(c=c(o)c1(=c(c=cc=c1)c(o)=2)))c)c)c
