Difference between revisions of "5-Phospho-RNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * molecular-weight: ** 228.204 * inchi-key: ** mxhrcpnrjammim-shyzeuofsa-n * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite ARSENATE == * common-name: ** arsenate * molecular-weight: ** 139.927 * inchi-key: ** djhgafsjwgloiv-uhfffaoysa-l * smiles: ** [as](=o)(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite DEOXYURIDINE ==
+
== Metabolite ARSENATE ==
 
* common-name:
 
* common-name:
−
** 2'-deoxyuridine
+
** arsenate
 
* molecular-weight:
 
* molecular-weight:
−
** 228.204
+
** 139.927
 
* inchi-key:
 
* inchi-key:
−
** mxhrcpnrjammim-shyzeuofsa-n
+
** djhgafsjwgloiv-uhfffaoysa-l
 
* smiles:
 
* smiles:
−
** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2))
+
** [as](=o)(o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[CYTIDEAM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=2'-deoxyuridine}}
+
{{#set: common-name=arsenate}}
−
{{#set: molecular-weight=228.204}}
+
{{#set: molecular-weight=139.927}}
−
{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
+
{{#set: inchi-key=inchikey=djhgafsjwgloiv-uhfffaoysa-l}}

Revision as of 17:54, 13 January 2021

Metabolite ARSENATE

  • common-name:
    • arsenate
  • molecular-weight:
    • 139.927
  • inchi-key:
    • djhgafsjwgloiv-uhfffaoysa-l
  • smiles:
    • [as](=o)(o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=5-Phospho-RNA&oldid=17988"