Difference between revisions of "CPD-18076"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * molecular-weight: ** 867.61 * inchi-key: ** vevjtunlalkrno-tyhxjlicsa-j * smiles: ** cc(c)(...")
 
(Created page with "Category:metabolite == Metabolite TRANS-D2-ENOYL-COA == * common-name: ** a trans-2-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-HYDRAT-RXN *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BENZOYLCOA ==
+
== Metabolite TRANS-D2-ENOYL-COA ==
 
* common-name:
 
* common-name:
** benzoyl-coa
+
** a trans-2-enoyl-coa
* molecular-weight:
 
** 867.61
 
* inchi-key:
 
** vevjtunlalkrno-tyhxjlicsa-j
 
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
* [[TRANSENOYLCOARED-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2006]]
+
* [[ACYL-COA-OXIDASE-RXN]]
 +
* [[ACYLCOADEHYDROG-RXN]]
 +
* [[RXN-11026]]
 +
* [[RXN-7911]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzoyl-coa}}
+
{{#set: common-name=a trans-2-enoyl-coa}}
{{#set: molecular-weight=867.61}}
 
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
 

Revision as of 17:54, 13 January 2021

Metabolite TRANS-D2-ENOYL-COA

  • common-name:
    • a trans-2-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality