Difference between revisions of "Glycogens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8901 == * common-name: ** a [protein] n6-methyl-l-lysine == Reaction(s) known to consume the compound == * RXN-8661 == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * molecular-weight: ** 182.138 * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * smiles: ** cn1(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12481 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-methylurate |
| + | * molecular-weight: | ||
| + | ** 182.138 | ||
| + | * inchi-key: | ||
| + | ** yhnnpkufpwltop-uhfffaoysa-n | ||
| + | * smiles: | ||
| + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11521]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-methylurate}} |
| + | {{#set: molecular-weight=182.138}} | ||
| + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} | ||
Revision as of 17:55, 13 January 2021
Contents
Metabolite CPD-12481
- common-name:
- 7-methylurate
- molecular-weight:
- 182.138
- inchi-key:
- yhnnpkufpwltop-uhfffaoysa-n
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
