Difference between revisions of "EIF5A-HYPUSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * molecular-weight: ** 157.105 * inchi-key: ** ufivepvsagbusi-reohclbhsa-m * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite DI-H-OROTATE ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** (s)-dihydroorotate
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 157.105
 
* inchi-key:
 
* inchi-key:
** luewuzlmquobsb-ayqjavfrsa-n
+
** ufivepvsagbusi-reohclbhsa-m
 
* smiles:
 
* smiles:
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[DIHYDROOROT-RXN]]
 +
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 +
* [[RXN0-6491]]
 +
* [[RXN0-6554]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[DIHYDROOROT-RXN]]
* [[RXN-14284]]
+
* [[RXN0-6490]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=(s)-dihydroorotate}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=157.105}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
+
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}

Revision as of 17:55, 13 January 2021

Metabolite DI-H-OROTATE

  • common-name:
    • (s)-dihydroorotate
  • molecular-weight:
    • 157.105
  • inchi-key:
    • ufivepvsagbusi-reohclbhsa-m
  • smiles:
    • c1(c(=o)nc(=o)nc(c(=o)[o-])1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality