Difference between revisions of "TRANS-D2-ENOYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * molecular-weight: ** 361.207 * inchi-key: ** rqfcjasxjcidsx-uuokfmhzsa-l * smiles: ** c(op(=o)([o-])[o-])c...") |
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * molecular-weight: ** 943.749 * inchi-key: ** xbfqfvlnmjddng-dupkwvsksa-j *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15678 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-trans-3-oxo-undecenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 943.749 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xbfqfvlnmjddng-dupkwvsksa-j |
* smiles: | * smiles: | ||
− | ** c(op(=o)([o-])[o-]) | + | ** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14793]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-trans-3-oxo-undecenoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=943.749}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite CPD-15678
- common-name:
- 4-trans-3-oxo-undecenoyl-coa
- molecular-weight:
- 943.749
- inchi-key:
- xbfqfvlnmjddng-dupkwvsksa-j
- smiles:
- ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]