Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GMP == * common-name: ** gmp * molecular-weight: ** 361.207 * inchi-key: ** rqfcjasxjcidsx-uuokfmhzsa-l * smiles: ** c(op(=o)([o-])[o-])c...")
 
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * molecular-weight: ** 943.749 * inchi-key: ** xbfqfvlnmjddng-dupkwvsksa-j *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GMP ==
+
== Metabolite CPD-15678 ==
 
* common-name:
 
* common-name:
** gmp
+
** 4-trans-3-oxo-undecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 361.207
+
** 943.749
 
* inchi-key:
 
* inchi-key:
** rqfcjasxjcidsx-uuokfmhzsa-l
+
** xbfqfvlnmjddng-dupkwvsksa-j
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GUANYL-KIN-RXN]]
+
* [[RXN-14793]]
* [[RXN-7609]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
 
* [[GMP-SYN-GLUT-RXN]]
 
* [[GMP-SYN-NH3-RXN]]
 
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 
* [[GUANYL-KIN-RXN]]
 
* [[RXN-14140]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gmp}}
+
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
{{#set: molecular-weight=361.207}}
+
{{#set: molecular-weight=943.749}}
{{#set: inchi-key=inchikey=rqfcjasxjcidsx-uuokfmhzsa-l}}
+
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}

Revision as of 17:55, 13 January 2021

Metabolite CPD-15678

  • common-name:
    • 4-trans-3-oxo-undecenoyl-coa
  • molecular-weight:
    • 943.749
  • inchi-key:
    • xbfqfvlnmjddng-dupkwvsksa-j
  • smiles:
    • ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality